C18H24ClN5O10P2 — CID 167190914
[[(2S,4R,5R)-5-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-6-chloropyrazolo[5,4-d]pyrimidin-1-yl]-3-formyl-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 167190914) has the molecular formula C18H24ClN5O10P2 and a molecular weight of 567.82 g/mol. Its IUPAC name is [[(2S,4R,5R)-5-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-6-chloropyrazolo[5,4-d]pyrimidin-1-yl]-3-formyl-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2S,4R,5R)-5-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-6-chloropyrazolo[5,4-d]pyrimidin-1-yl]-3-formyl-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 167190914 |
| Molecular Formula | C18H24ClN5O10P2 |
| Molecular Weight | 567.82 g/mol |
| Exact Mass | 567.07 |
| IUPAC Name | [[(2S,4R,5R)-5-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-6-chloropyrazolo[5,4-d]pyrimidin-1-yl]-3-formyl-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=CC1[C@@H](O)[C@H](n2ncc3c(N4CC5COCC5C4)nc(Cl)nc32)O[C@@H]1COP(=O)(O)CP(=O)(O)O |
| InChI | InChI=1S/C18H24ClN5O10P2/c19-18-21-15(23-2-9-5-32-6-10(9)3-23)11-1-20-24(16(11)22-18)17-14(26)12(4-25)13(34-17)7-33-36(30,31)8-35(27,28)29/h1,4,9-10,12-14,17,26H,2-3,5-8H2,(H,30,31)(H2,27,28,29)/t9?,10?,12?,13-,14-,17-/m1/s1 |
| InChIKey | NOGAATADFNRQEM-DEHIALNISA-N |
| XLogP | -0.03 |
| TPSA | 206.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.82 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|