C16H23ClFN5O8P2 — CID 139571718
[[(2R,3R,4S,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 139571718) has the molecular formula C16H23ClFN5O8P2 and a molecular weight of 529.79 g/mol. Its IUPAC name is [[(2R,3R,4S,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3R,4S,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 139571718 |
| Molecular Formula | C16H23ClFN5O8P2 |
| Molecular Weight | 529.79 g/mol |
| Exact Mass | 529.07 |
| IUPAC Name | [[(2R,3R,4S,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](n2ncc3c(NC4CCCC4)nc(Cl)nc32)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C16H23ClFN5O8P2/c17-16-21-13(20-8-3-1-2-4-8)9-5-19-23(14(9)22-16)15-11(18)12(24)10(31-15)6-30-33(28,29)7-32(25,26)27/h5,8,10-12,15,24H,1-4,6-7H2,(H,28,29)(H,20,21,22)(H2,25,26,27)/t10-,11+,12-,15-/m1/s1 |
| InChIKey | WZOVJMPFGXZPFV-NWJSVONSSA-N |
| XLogP | 1.77 |
| TPSA | 189.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.79 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|