C18H25ClN5O8P — CID 153359220
[3-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]oxetan-3-yl]phosphonic acid (PubChem CID 153359220) has the molecular formula C18H25ClN5O8P and a molecular weight of 505.85 g/mol. Its IUPAC name is [3-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]oxetan-3-yl]phosphonic acid.
| Compound Name | [3-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]oxetan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 153359220 |
| Molecular Formula | C18H25ClN5O8P |
| Molecular Weight | 505.85 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | [3-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]oxetan-3-yl]phosphonic acid |
| SMILES | O=P(O)(O)C1(OC[C@H]2O[C@@H](n3ncc4c(NC5CCCC5)nc(Cl)nc43)[C@H](O)[C@@H]2O)COC1 |
| InChI | InChI=1S/C18H25ClN5O8P/c19-17-22-14(21-9-3-1-2-4-9)10-5-20-24(15(10)23-17)16-13(26)12(25)11(32-16)6-31-18(7-30-8-18)33(27,28)29/h5,9,11-13,16,25-26H,1-4,6-8H2,(H,21,22,23)(H2,27,28,29)/t11-,12-,13-,16-/m1/s1 |
| InChIKey | JAOQXUPIVROWPZ-BRXULGCHSA-N |
| XLogP | 0.37 |
| TPSA | 181.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.85 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|