C22H29ClN7O8P — CID 175732723
[(2R)-2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-3-pyrimidin-2-ylpropan-2-yl]phosphonic acid (PubChem CID 175732723) has the molecular formula C22H29ClN7O8P and a molecular weight of 585.94 g/mol. Its IUPAC name is [(2R)-2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-3-pyrimidin-2-ylpropan-2-yl]phosphonic acid.
| Compound Name | [(2R)-2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-3-pyrimidin-2-ylpropan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 175732723 |
| Molecular Formula | C22H29ClN7O8P |
| Molecular Weight | 585.94 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | [(2R)-2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-3-pyrimidin-2-ylpropan-2-yl]phosphonic acid |
| SMILES | O=P(O)(O)[C@@](CO)(Cc1ncccn1)OC[C@H]1O[C@@H](n2ncc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H29ClN7O8P/c23-21-28-18(27-12-4-1-2-5-12)13-9-26-30(19(13)29-21)20-17(33)16(32)14(38-20)10-37-22(11-31,39(34,35)36)8-15-24-6-3-7-25-15/h3,6-7,9,12,14,16-17,20,31-33H,1-2,4-5,8,10-11H2,(H,27,28,29)(H2,34,35,36)/t14-,16-,17-,20-,22-/m1/s1 |
| InChIKey | WHRMWWDQCJOOMK-CRPJPYKISA-N |
| XLogP | 0.37 |
| TPSA | 218.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.94 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|