C20H31ClN5O10P — CID 148586099
[2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-3-(2-hydroxyethoxy)propan-2-yl]phosphonic acid (PubChem CID 148586099) has the molecular formula C20H31ClN5O10P and a molecular weight of 567.92 g/mol. Its IUPAC name is [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-3-(2-hydroxyethoxy)propan-2-yl]phosphonic acid.
| Compound Name | [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-3-(2-hydroxyethoxy)propan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 148586099 |
| Molecular Formula | C20H31ClN5O10P |
| Molecular Weight | 567.92 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-3-(2-hydroxyethoxy)propan-2-yl]phosphonic acid |
| SMILES | O=P(O)(O)C(CO)(COCCO)OC[C@H]1O[C@@H](n2ncc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H31ClN5O10P/c21-19-24-16(23-11-3-1-2-4-11)12-7-22-26(17(12)25-19)18-15(30)14(29)13(36-18)8-35-20(9-28,37(31,32)33)10-34-6-5-27/h7,11,13-15,18,27-30H,1-6,8-10H2,(H,23,24,25)(H2,31,32,33)/t13-,14-,15-,18-,20?/m1/s1 |
| InChIKey | MZSNAFULIPWVQK-FSXPKSEBSA-N |
| XLogP | -0.65 |
| TPSA | 221.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.92 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|