C20H29ClN5O10P — CID 175732706
[(2R)-2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-ethoxy-3-hydroxy-1-oxopropan-2-yl]phosphonic acid (PubChem CID 175732706) has the molecular formula C20H29ClN5O10P and a molecular weight of 565.90 g/mol. Its IUPAC name is [(2R)-2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-ethoxy-3-hydroxy-1-oxopropan-2-yl]phosphonic acid.
| Compound Name | [(2R)-2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-ethoxy-3-hydroxy-1-oxopropan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 175732706 |
| Molecular Formula | C20H29ClN5O10P |
| Molecular Weight | 565.90 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | [(2R)-2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-ethoxy-3-hydroxy-1-oxopropan-2-yl]phosphonic acid |
| SMILES | CCOC(=O)[C@](CO)(OC[C@H]1O[C@@H](n2ncc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C20H29ClN5O10P/c1-2-34-18(30)20(9-27,37(31,32)33)35-8-12-13(28)14(29)17(36-12)26-16-11(7-22-26)15(24-19(21)25-16)23-10-5-3-4-6-10/h7,10,12-14,17,27-29H,2-6,8-9H2,1H3,(H,23,24,25)(H2,31,32,33)/t12-,13-,14-,17-,20-/m1/s1 |
| InChIKey | XUNKWXDAMRSRTD-LRLGCNRVSA-N |
| XLogP | -0.10 |
| TPSA | 218.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.90 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|