C20H24Cl2N5O9P — CID 153209874
[2-[[(2R,3S,4R,5R)-5-[6-chloro-4-[(4-chlorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1,3-dihydroxypropan-2-yl]phosphonic acid (PubChem CID 153209874) has the molecular formula C20H24Cl2N5O9P and a molecular weight of 580.32 g/mol. Its IUPAC name is [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-[(4-chlorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1,3-dihydroxypropan-2-yl]phosphonic acid.
| Compound Name | [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-[(4-chlorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1,3-dihydroxypropan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 153209874 |
| Molecular Formula | C20H24Cl2N5O9P |
| Molecular Weight | 580.32 g/mol |
| Exact Mass | 579.07 |
| IUPAC Name | [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-[(4-chlorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1,3-dihydroxypropan-2-yl]phosphonic acid |
| SMILES | O=P(O)(O)C(CO)(CO)OC[C@H]1O[C@@H](n2ncc3c(NCc4ccc(Cl)cc4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H24Cl2N5O9P/c21-11-3-1-10(2-4-11)5-23-16-12-6-24-27(17(12)26-19(22)25-16)18-15(31)14(30)13(36-18)7-35-20(8-28,9-29)37(32,33)34/h1-4,6,13-15,18,28-31H,5,7-9H2,(H,23,25,26)(H2,32,33,34)/t13-,14-,15-,18-/m1/s1 |
| InChIKey | WLOPZADTHRGLSO-ATNYBXOESA-N |
| XLogP | 0.24 |
| TPSA | 212.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.32 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|