C20H23ClF3N5O9P2 — CID 155657027
[[(2R,3S,4R,5R)-5-[6-chloro-4-[[(2R)-1,1,1-trifluoro-3-phenylpropan-2-yl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155657027) has the molecular formula C20H23ClF3N5O9P2 and a molecular weight of 631.83 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[6-chloro-4-[[(2R)-1,1,1-trifluoro-3-phenylpropan-2-yl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[6-chloro-4-[[(2R)-1,1,1-trifluoro-3-phenylpropan-2-yl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155657027 |
| Molecular Formula | C20H23ClF3N5O9P2 |
| Molecular Weight | 631.83 g/mol |
| Exact Mass | 631.06 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[6-chloro-4-[[(2R)-1,1,1-trifluoro-3-phenylpropan-2-yl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](n2ncc3c(N[C@H](Cc4ccccc4)C(F)(F)F)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H23ClF3N5O9P2/c21-19-27-16(26-13(20(22,23)24)6-10-4-2-1-3-5-10)11-7-25-29(17(11)28-19)18-15(31)14(30)12(38-18)8-37-40(35,36)9-39(32,33)34/h1-5,7,12-15,18,30-31H,6,8-9H2,(H,35,36)(H,26,27,28)(H2,32,33,34)/t12-,13-,14-,15-,18-/m1/s1 |
| InChIKey | KCWAHVLHYZXCGV-VFCJXBEMSA-N |
| XLogP | 2.02 |
| TPSA | 209.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.83 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|