C19H21ClF3N5O10P2 — CID 155444398
[[(2R,4S,5R)-5-[6-chloro-4-[[(1R)-2,2,2-trifluoro-1-phenylethyl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,3,4-trihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155444398) has the molecular formula C19H21ClF3N5O10P2 and a molecular weight of 633.80 g/mol. Its IUPAC name is [[(2R,4S,5R)-5-[6-chloro-4-[[(1R)-2,2,2-trifluoro-1-phenylethyl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,3,4-trihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,4S,5R)-5-[6-chloro-4-[[(1R)-2,2,2-trifluoro-1-phenylethyl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,3,4-trihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155444398 |
| Molecular Formula | C19H21ClF3N5O10P2 |
| Molecular Weight | 633.80 g/mol |
| Exact Mass | 633.04 |
| IUPAC Name | [[(2R,4S,5R)-5-[6-chloro-4-[[(1R)-2,2,2-trifluoro-1-phenylethyl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,3,4-trihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](n2ncc3c(N[C@H](c4ccccc4)C(F)(F)F)nc(Cl)nc32)[C@H](O)C1(O)O |
| InChI | InChI=1S/C19H21ClF3N5O10P2/c20-17-26-14(25-12(19(21,22)23)9-4-2-1-3-5-9)10-6-24-28(15(10)27-17)16-13(29)18(30,31)11(38-16)7-37-40(35,36)8-39(32,33)34/h1-6,11-13,16,29-31H,7-8H2,(H,35,36)(H,25,26,27)(H2,32,33,34)/t11-,12-,13+,16-/m1/s1 |
| InChIKey | JSAUFAGRIRJSGG-NFFDBFGFSA-N |
| XLogP | 1.47 |
| TPSA | 229.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.80 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|