C20H24ClFN4O8P2 — CID 138475624
[[(2R,3R,4S,5R)-5-[2-chloro-4-(1-phenylethylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 138475624) has the molecular formula C20H24ClFN4O8P2 and a molecular weight of 564.83 g/mol. Its IUPAC name is [[(2R,3R,4S,5R)-5-[2-chloro-4-(1-phenylethylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3R,4S,5R)-5-[2-chloro-4-(1-phenylethylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 138475624 |
| Molecular Formula | C20H24ClFN4O8P2 |
| Molecular Weight | 564.83 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | [[(2R,3R,4S,5R)-5-[2-chloro-4-(1-phenylethylamino)pyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CC(Nc1nc(Cl)nc2c1ccn2[C@@H]1O[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@@H]1F)c1ccccc1 |
| InChI | InChI=1S/C20H24ClFN4O8P2/c1-11(12-5-3-2-4-6-12)23-17-13-7-8-26(18(13)25-20(21)24-17)19-15(22)16(27)14(34-19)9-33-36(31,32)10-35(28,29)30/h2-8,11,14-16,19,27H,9-10H2,1H3,(H,31,32)(H,23,24,25)(H2,28,29,30)/t11?,14-,15+,16-,19-/m1/s1 |
| InChIKey | OJYUQEGQYIAHEI-NIZKQVLPSA-N |
| XLogP | 3.19 |
| TPSA | 176.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.83 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|