C20H24ClN4O7P — CID 146473022
[(2R,3S,4R,5R)-5-[2-chloro-4-[[(1R)-1-phenylethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 146473022) has the molecular formula C20H24ClN4O7P and a molecular weight of 498.86 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[2-chloro-4-[[(1R)-1-phenylethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[2-chloro-4-[[(1R)-1-phenylethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 146473022 |
| Molecular Formula | C20H24ClN4O7P |
| Molecular Weight | 498.86 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[2-chloro-4-[[(1R)-1-phenylethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | C[C@@H](Nc1nc(Cl)nc2c1ccn2[C@@H]1O[C@H](COCP(=O)(O)O)[C@@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C20H24ClN4O7P/c1-11(12-5-3-2-4-6-12)22-17-13-7-8-25(18(13)24-20(21)23-17)19-16(27)15(26)14(32-19)9-31-10-33(28,29)30/h2-8,11,14-16,19,26-27H,9-10H2,1H3,(H,22,23,24)(H2,28,29,30)/t11-,14-,15-,16-,19-/m1/s1 |
| InChIKey | NCNVSGQRVZJVDU-DANYHQEZSA-N |
| XLogP | 2.03 |
| TPSA | 159.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.86 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|