C20H23N6O7P — CID 146472878
[(2R,3S,4R,5R)-5-[2-cyano-6-(1-phenylethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 146472878) has the molecular formula C20H23N6O7P and a molecular weight of 490.41 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[2-cyano-6-(1-phenylethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[2-cyano-6-(1-phenylethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 146472878 |
| Molecular Formula | C20H23N6O7P |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[2-cyano-6-(1-phenylethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | CC(Nc1nc(C#N)nc2c1ncn2[C@@H]1O[C@H](COCP(=O)(O)O)[C@@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C20H23N6O7P/c1-11(12-5-3-2-4-6-12)23-18-15-19(25-14(7-21)24-18)26(9-22-15)20-17(28)16(27)13(33-20)8-32-10-34(29,30)31/h2-6,9,11,13,16-17,20,27-28H,8,10H2,1H3,(H,23,24,25)(H2,29,30,31)/t11?,13-,16-,17-,20-/m1/s1 |
| InChIKey | QNTDMCJIWVWQAM-OFGIKRIPSA-N |
| XLogP | 0.64 |
| TPSA | 195.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|