C22H22ClN6O7P — CID 170699114
[(2R,3S,4R,5R)-5-[6-chloro-4-[(2E)-2-(naphthalen-1-ylmethylidene)hydrazinyl]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 170699114) has the molecular formula C22H22ClN6O7P and a molecular weight of 548.88 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-chloro-4-[(2E)-2-(naphthalen-1-ylmethylidene)hydrazinyl]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[6-chloro-4-[(2E)-2-(naphthalen-1-ylmethylidene)hydrazinyl]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 170699114 |
| Molecular Formula | C22H22ClN6O7P |
| Molecular Weight | 548.88 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-chloro-4-[(2E)-2-(naphthalen-1-ylmethylidene)hydrazinyl]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | O=P(O)(O)COC[C@H]1O[C@@H](n2ncc3c(N/N=C/c4cccc5ccccc45)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H22ClN6O7P/c23-22-26-19(28-24-8-13-6-3-5-12-4-1-2-7-14(12)13)15-9-25-29(20(15)27-22)21-18(31)17(30)16(36-21)10-35-11-37(32,33)34/h1-9,16-18,21,30-31H,10-11H2,(H,26,27,28)(H2,32,33,34)/b24-8+/t16-,17-,18-,21-/m1/s1 |
| InChIKey | OUHAHBSKMRADAJ-WXPCSISVSA-N |
| XLogP | 1.85 |
| TPSA | 184.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.88 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|