C17H24ClN4O7P — CID 161188518
[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylmethyl)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 161188518) has the molecular formula C17H24ClN4O7P and a molecular weight of 462.83 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylmethyl)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylmethyl)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 161188518 |
| Molecular Formula | C17H24ClN4O7P |
| Molecular Weight | 462.83 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylmethyl)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | O=P(O)(O)COC[C@H]1O[C@@H](n2ncc3c(CC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H24ClN4O7P/c18-17-20-11(5-9-3-1-2-4-9)10-6-19-22(15(10)21-17)16-14(24)13(23)12(29-16)7-28-8-30(25,26)27/h6,9,12-14,16,23-24H,1-5,7-8H2,(H2,25,26,27)/t12-,13-,14-,16-/m1/s1 |
| InChIKey | UTKDTUIWRUQQQY-IXYNUQLISA-N |
| XLogP | 0.98 |
| TPSA | 160.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.83 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|