C19H22Cl2N5O7P — CID 142587090
[(2R,5R,6R)-6-[6-chloro-4-[(2-chlorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,5-dihydroxyoxan-2-yl]methoxymethylphosphonic acid (PubChem CID 142587090) has the molecular formula C19H22Cl2N5O7P and a molecular weight of 534.29 g/mol. Its IUPAC name is [(2R,5R,6R)-6-[6-chloro-4-[(2-chlorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,5-dihydroxyoxan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,5R,6R)-6-[6-chloro-4-[(2-chlorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,5-dihydroxyoxan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 142587090 |
| Molecular Formula | C19H22Cl2N5O7P |
| Molecular Weight | 534.29 g/mol |
| Exact Mass | 533.06 |
| IUPAC Name | [(2R,5R,6R)-6-[6-chloro-4-[(2-chlorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,5-dihydroxyoxan-2-yl]methoxymethylphosphonic acid |
| SMILES | O=P(O)(O)COC[C@H]1O[C@@H](n2ncc3c(NCc4ccccc4Cl)nc(Cl)nc32)[C@H](O)CC1O |
| InChI | InChI=1S/C19H22Cl2N5O7P/c20-12-4-2-1-3-10(12)6-22-16-11-7-23-26(17(11)25-19(21)24-16)18-14(28)5-13(27)15(33-18)8-32-9-34(29,30)31/h1-4,7,13-15,18,27-28H,5-6,8-9H2,(H,22,24,25)(H2,29,30,31)/t13?,14-,15-,18-/m1/s1 |
| InChIKey | ABAPPTCQCDROPH-LIKLURFNSA-N |
| XLogP | 1.91 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|