C17H20ClN6O6P — CID 154988342
[(2R,3S)-5-[2-chloro-6-(pyridin-2-ylmethylamino)purin-9-yl]-3-hydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 154988342) has the molecular formula C17H20ClN6O6P and a molecular weight of 470.81 g/mol. Its IUPAC name is [(2R,3S)-5-[2-chloro-6-(pyridin-2-ylmethylamino)purin-9-yl]-3-hydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S)-5-[2-chloro-6-(pyridin-2-ylmethylamino)purin-9-yl]-3-hydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 154988342 |
| Molecular Formula | C17H20ClN6O6P |
| Molecular Weight | 470.81 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | [(2R,3S)-5-[2-chloro-6-(pyridin-2-ylmethylamino)purin-9-yl]-3-hydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | O=P(O)(O)COC[C@H]1OC(n2cnc3c(NCc4ccccn4)nc(Cl)nc32)C[C@@H]1O |
| InChI | InChI=1S/C17H20ClN6O6P/c18-17-22-15(20-6-10-3-1-2-4-19-10)14-16(23-17)24(8-21-14)13-5-11(25)12(30-13)7-29-9-31(26,27)28/h1-4,8,11-13,25H,5-7,9H2,(H,20,22,23)(H2,26,27,28)/t11-,12+,13?/m0/s1 |
| InChIKey | XTFFUZUBBKONMK-LAGVYOHYSA-N |
| XLogP | 1.29 |
| TPSA | 164.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.81 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|