C20H23ClN5O7P — CID 175853873
[(1R,2S,3R,4R)-4-[2-chloro-6-(2-phenylethylamino)purin-9-yl]-2,3-dihydroxy-5-oxocyclopentyl]methoxymethylphosphonic acid (PubChem CID 175853873) has the molecular formula C20H23ClN5O7P and a molecular weight of 511.86 g/mol. Its IUPAC name is [(1R,2S,3R,4R)-4-[2-chloro-6-(2-phenylethylamino)purin-9-yl]-2,3-dihydroxy-5-oxocyclopentyl]methoxymethylphosphonic acid.
| Compound Name | [(1R,2S,3R,4R)-4-[2-chloro-6-(2-phenylethylamino)purin-9-yl]-2,3-dihydroxy-5-oxocyclopentyl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 175853873 |
| Molecular Formula | C20H23ClN5O7P |
| Molecular Weight | 511.86 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | [(1R,2S,3R,4R)-4-[2-chloro-6-(2-phenylethylamino)purin-9-yl]-2,3-dihydroxy-5-oxocyclopentyl]methoxymethylphosphonic acid |
| SMILES | O=C1[C@H](COCP(=O)(O)O)[C@H](O)[C@H](O)[C@H]1n1cnc2c(NCCc3ccccc3)nc(Cl)nc21 |
| InChI | InChI=1S/C20H23ClN5O7P/c21-20-24-18(22-7-6-11-4-2-1-3-5-11)13-19(25-20)26(9-23-13)14-15(27)12(16(28)17(14)29)8-33-10-34(30,31)32/h1-5,9,12,14,16-17,28-29H,6-8,10H2,(H,22,24,25)(H2,30,31,32)/t12-,14-,16-,17+/m0/s1 |
| InChIKey | QZYDSIGOSRXNTO-ZFZWDLNGSA-N |
| XLogP | 0.75 |
| TPSA | 179.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.86 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|