C17H24ClN6O7P — CID 175853879
[(1R,2S,3R,4R)-4-[2-chloro-6-[(1-methylpyrrolidin-3-yl)amino]purin-9-yl]-2,3-dihydroxy-5-oxocyclopentyl]methoxymethylphosphonic acid (PubChem CID 175853879) has the molecular formula C17H24ClN6O7P and a molecular weight of 490.84 g/mol. Its IUPAC name is [(1R,2S,3R,4R)-4-[2-chloro-6-[(1-methylpyrrolidin-3-yl)amino]purin-9-yl]-2,3-dihydroxy-5-oxocyclopentyl]methoxymethylphosphonic acid.
| Compound Name | [(1R,2S,3R,4R)-4-[2-chloro-6-[(1-methylpyrrolidin-3-yl)amino]purin-9-yl]-2,3-dihydroxy-5-oxocyclopentyl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 175853879 |
| Molecular Formula | C17H24ClN6O7P |
| Molecular Weight | 490.84 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | [(1R,2S,3R,4R)-4-[2-chloro-6-[(1-methylpyrrolidin-3-yl)amino]purin-9-yl]-2,3-dihydroxy-5-oxocyclopentyl]methoxymethylphosphonic acid |
| SMILES | CN1CCC(Nc2nc(Cl)nc3c2ncn3[C@H]2C(=O)[C@H](COCP(=O)(O)O)[C@H](O)[C@@H]2O)C1 |
| InChI | InChI=1S/C17H24ClN6O7P/c1-23-3-2-8(4-23)20-15-10-16(22-17(18)21-15)24(6-19-10)11-12(25)9(13(26)14(11)27)5-31-7-32(28,29)30/h6,8-9,11,13-14,26-27H,2-5,7H2,1H3,(H,20,21,22)(H2,28,29,30)/t8?,9-,11-,13-,14+/m0/s1 |
| InChIKey | ZMELFCCJCDMGAB-OSZNXQCUSA-N |
| XLogP | -0.79 |
| TPSA | 183.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.84 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|