C19H27ClN5O8P — CID 175853832
[(1R,2S,3R,4R)-4-[2-chloro-6-[4-(methoxymethyl)piperidin-1-yl]purin-9-yl]-2,3-dihydroxy-5-oxocyclopentyl]methoxymethylphosphonic acid (PubChem CID 175853832) has the molecular formula C19H27ClN5O8P and a molecular weight of 519.88 g/mol. Its IUPAC name is [(1R,2S,3R,4R)-4-[2-chloro-6-[4-(methoxymethyl)piperidin-1-yl]purin-9-yl]-2,3-dihydroxy-5-oxocyclopentyl]methoxymethylphosphonic acid.
| Compound Name | [(1R,2S,3R,4R)-4-[2-chloro-6-[4-(methoxymethyl)piperidin-1-yl]purin-9-yl]-2,3-dihydroxy-5-oxocyclopentyl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 175853832 |
| Molecular Formula | C19H27ClN5O8P |
| Molecular Weight | 519.88 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | [(1R,2S,3R,4R)-4-[2-chloro-6-[4-(methoxymethyl)piperidin-1-yl]purin-9-yl]-2,3-dihydroxy-5-oxocyclopentyl]methoxymethylphosphonic acid |
| SMILES | COCC1CCN(c2nc(Cl)nc3c2ncn3[C@H]2C(=O)[C@H](COCP(=O)(O)O)[C@H](O)[C@@H]2O)CC1 |
| InChI | InChI=1S/C19H27ClN5O8P/c1-32-6-10-2-4-24(5-3-10)17-12-18(23-19(20)22-17)25(8-21-12)13-14(26)11(15(27)16(13)28)7-33-9-34(29,30)31/h8,10-11,13,15-16,27-28H,2-7,9H2,1H3,(H2,29,30,31)/t11-,13-,15-,16+/m0/s1 |
| InChIKey | WTAZGCMVJNJQSP-DLKVLKDVSA-N |
| XLogP | -0.04 |
| TPSA | 180.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.88 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|