C17H25ClN5O7P — CID 153325452
[(2R,3S,4R,5R)-5-[2-chloro-6-[(1-methylcyclopentyl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 153325452) has the molecular formula C17H25ClN5O7P and a molecular weight of 477.84 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[2-chloro-6-[(1-methylcyclopentyl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[2-chloro-6-[(1-methylcyclopentyl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 153325452 |
| Molecular Formula | C17H25ClN5O7P |
| Molecular Weight | 477.84 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[2-chloro-6-[(1-methylcyclopentyl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | CC1(Nc2nc(Cl)nc3c2ncn3[C@@H]2O[C@H](COCP(=O)(O)O)[C@@H](O)[C@H]2O)CCCC1 |
| InChI | InChI=1S/C17H25ClN5O7P/c1-17(4-2-3-5-17)22-13-10-14(21-16(18)20-13)23(7-19-10)15-12(25)11(24)9(30-15)6-29-8-31(26,27)28/h7,9,11-12,15,24-25H,2-6,8H2,1H3,(H,20,21,22)(H2,26,27,28)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | KHFXOUNGXFPDMD-SDBHATRESA-N |
| XLogP | 1.00 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.84 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|