C21H29ClN5O13P — CID 153325489
bis(methoxycarbonyloxy)methoxy-[[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl]phosphinic acid (PubChem CID 153325489) has the molecular formula C21H29ClN5O13P and a molecular weight of 625.91 g/mol. Its IUPAC name is bis(methoxycarbonyloxy)methoxy-[[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl]phosphinic acid.
| Compound Name | bis(methoxycarbonyloxy)methoxy-[[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl]phosphinic acid |
|---|---|
| PubChem CID | 153325489 |
| Molecular Formula | C21H29ClN5O13P |
| Molecular Weight | 625.91 g/mol |
| Exact Mass | 625.12 |
| IUPAC Name | bis(methoxycarbonyloxy)methoxy-[[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl]phosphinic acid |
| SMILES | COC(=O)OC(OC(=O)OC)OP(=O)(O)COC[C@H]1O[C@@H](n2cnc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H29ClN5O13P/c1-34-19(30)38-21(39-20(31)35-2)40-41(32,33)9-36-7-11-13(28)14(29)17(37-11)27-8-23-12-15(24-10-5-3-4-6-10)25-18(22)26-16(12)27/h8,10-11,13-14,17,21,28-29H,3-7,9H2,1-2H3,(H,32,33)(H,24,25,26)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | SCWDADFOOYPPCH-LSCFUAHRSA-N |
| XLogP | 1.48 |
| TPSA | 232.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.91 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|