C21H31ClN5O9P — CID 154988349
[(2S,4R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]methoxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid (PubChem CID 154988349) has the molecular formula C21H31ClN5O9P and a molecular weight of 563.93 g/mol. Its IUPAC name is [(2S,4R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]methoxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid.
| Compound Name | [(2S,4R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]methoxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 154988349 |
| Molecular Formula | C21H31ClN5O9P |
| Molecular Weight | 563.93 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | [(2S,4R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]methoxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid |
| SMILES | CC(C)OC(=O)OCOP(=O)(O)COC[C@@H]1C[C@@H](O)C(n2cnc3c(NC4CCCC4)nc(Cl)nc32)O1 |
| InChI | InChI=1S/C21H31ClN5O9P/c1-12(2)35-21(29)33-10-34-37(30,31)11-32-8-14-7-15(28)19(36-14)27-9-23-16-17(24-13-5-3-4-6-13)25-20(22)26-18(16)27/h9,12-15,19,28H,3-8,10-11H2,1-2H3,(H,30,31)(H,24,25,26)/t14-,15+,19?/m0/s1 |
| InChIKey | CMKIJBOECMKIEJ-FPHLKLNRSA-N |
| XLogP | 3.18 |
| TPSA | 176.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.93 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|