C30H47ClN5O12P — CID 166644896
[[(2S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]methoxymethyl-(2,2-dimethylpropoxycarbonyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropyl carbonate (PubChem CID 166644896) has the molecular formula C30H47ClN5O12P and a molecular weight of 736.16 g/mol. Its IUPAC name is [[(2S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]methoxymethyl-(2,2-dimethylpropoxycarbonyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropyl carbonate.
| Compound Name | [[(2S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]methoxymethyl-(2,2-dimethylpropoxycarbonyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropyl carbonate |
|---|---|
| PubChem CID | 166644896 |
| Molecular Formula | C30H47ClN5O12P |
| Molecular Weight | 736.16 g/mol |
| Exact Mass | 735.26 |
| IUPAC Name | [[(2S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]methoxymethyl-(2,2-dimethylpropoxycarbonyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropyl carbonate |
| SMILES | CC(C)(C)COC(=O)OCOP(=O)(COC[C@@H]1C[C@@H](O)[C@H](n2cnc3c(NC4CCCC4)nc(Cl)nc32)O1)OCOC(=O)OCC(C)(C)C |
| InChI | InChI=1S/C30H47ClN5O12P/c1-29(2,3)13-42-27(38)44-16-46-49(40,47-17-45-28(39)43-14-30(4,5)6)18-41-12-20-11-21(37)25(48-20)36-15-32-22-23(33-19-9-7-8-10-19)34-26(31)35-24(22)36/h15,19-21,25,37H,7-14,16-18H2,1-6H3,(H,33,34,35)/t20-,21+,25+/m0/s1 |
| InChIKey | CPFLRKWVPWYFMV-BPYKYCOYSA-N |
| XLogP | 6.00 |
| TPSA | 200.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.16 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|