C23H36N5O10PS — CID 171428869
[[(2S,5R)-5-(6-amino-2-sulfanylidene-1H-purin-9-yl)-4-hydroxyoxolan-2-yl]methoxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 171428869) has the molecular formula C23H36N5O10PS and a molecular weight of 605.61 g/mol. Its IUPAC name is [[(2S,5R)-5-(6-amino-2-sulfanylidene-1H-purin-9-yl)-4-hydroxyoxolan-2-yl]methoxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [[(2S,5R)-5-(6-amino-2-sulfanylidene-1H-purin-9-yl)-4-hydroxyoxolan-2-yl]methoxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 171428869 |
| Molecular Formula | C23H36N5O10PS |
| Molecular Weight | 605.61 g/mol |
| Exact Mass | 605.19 |
| IUPAC Name | [[(2S,5R)-5-(6-amino-2-sulfanylidene-1H-purin-9-yl)-4-hydroxyoxolan-2-yl]methoxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(COC[C@@H]1CC(O)[C@H](n2cnc3c(N)[nH]c(=S)nc32)O1)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C23H36N5O10PS/c1-22(2,3)19(30)34-10-36-39(32,37-11-35-20(31)23(4,5)6)12-33-8-13-7-14(29)18(38-13)28-9-25-15-16(24)26-21(40)27-17(15)28/h9,13-14,18,29H,7-8,10-12H2,1-6H3,(H3,24,26,27,40)/t13-,14?,18+/m0/s1 |
| InChIKey | LLGDDCOQRYVTSO-IXRXBBNISA-N |
| XLogP | 3.01 |
| TPSA | 199.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.61 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|