C22H34N5O8P — CID 90339170
[[3-(6-aminopurin-9-yl)cyclobutyl]oxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 90339170) has the molecular formula C22H34N5O8P and a molecular weight of 527.52 g/mol. Its IUPAC name is [[3-(6-aminopurin-9-yl)cyclobutyl]oxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [[3-(6-aminopurin-9-yl)cyclobutyl]oxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 90339170 |
| Molecular Formula | C22H34N5O8P |
| Molecular Weight | 527.52 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | [[3-(6-aminopurin-9-yl)cyclobutyl]oxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(COC1CC(n2cnc3c(N)ncnc32)C1)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C22H34N5O8P/c1-21(2,3)19(28)31-11-34-36(30,35-12-32-20(29)22(4,5)6)13-33-15-7-14(8-15)27-10-26-16-17(23)24-9-25-18(16)27/h9-10,14-15H,7-8,11-13H2,1-6H3,(H2,23,24,25) |
| InChIKey | KEJUPSOCFIKIEI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 166.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|