C23H34N5O7P — CID 91427047
[2-[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]ethenyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 91427047) has the molecular formula C23H34N5O7P and a molecular weight of 523.53 g/mol. Its IUPAC name is [2-[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]ethenyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [2-[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]ethenyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 91427047 |
| Molecular Formula | C23H34N5O7P |
| Molecular Weight | 523.53 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | [2-[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]ethenyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(C=CC1(Cn2cnc3c(N)ncnc32)CC1)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C23H34N5O7P/c1-21(2,3)19(29)32-14-34-36(31,35-15-33-20(30)22(4,5)6)10-9-23(7-8-23)11-28-13-27-16-17(24)25-12-26-18(16)28/h9-10,12-13H,7-8,11,14-15H2,1-6H3,(H2,24,25,26) |
| InChIKey | OUGMGPMVBZVEMB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 157.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|