C12H16N5O3P — CID 21070159
[(Z)-2-[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]prop-1-enyl]phosphonic acid (PubChem CID 21070159) has the molecular formula C12H16N5O3P and a molecular weight of 309.27 g/mol. Its IUPAC name is [(Z)-2-[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]prop-1-enyl]phosphonic acid.
| Compound Name | [(Z)-2-[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]prop-1-enyl]phosphonic acid |
|---|---|
| PubChem CID | 21070159 |
| Molecular Formula | C12H16N5O3P |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | [(Z)-2-[1-[(6-aminopurin-9-yl)methyl]cyclopropyl]prop-1-enyl]phosphonic acid |
| SMILES | C/C(=C/P(=O)(O)O)C1(Cn2cnc3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C12H16N5O3P/c1-8(4-21(18,19)20)12(2-3-12)5-17-7-16-9-10(13)14-6-15-11(9)17/h4,6-7H,2-3,5H2,1H3,(H2,13,14,15)(H2,18,19,20)/b8-4- |
| InChIKey | ARHXFHWUGBRYNL-YWEYNIOJSA-N |
| XLogP | 1.27 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|