C8H9N5O — CID 14258026
1-(6-aminopurin-9-yl)propan-2-one (PubChem CID 14258026) has the molecular formula C8H9N5O and a molecular weight of 191.19 g/mol. Its IUPAC name is 1-(6-aminopurin-9-yl)propan-2-one.
| Compound Name | 1-(6-aminopurin-9-yl)propan-2-one |
|---|---|
| PubChem CID | 14258026 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 1-(6-aminopurin-9-yl)propan-2-one |
| SMILES | CC(=O)Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C8H9N5O/c1-5(14)2-13-4-12-6-7(9)10-3-11-8(6)13/h3-4H,2H2,1H3,(H2,9,10,11) |
| InChIKey | QVVQIXZDNRKXPV-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |