C9H14N7O+ — CID 4184659
2-[[2-(6-aminopurin-9-yl)acetyl]amino]ethylazanium (PubChem CID 4184659) has the molecular formula C9H14N7O+ and a molecular weight of 236.26 g/mol. Its IUPAC name is 2-[[2-(6-aminopurin-9-yl)acetyl]amino]ethylazanium.
| Compound Name | 2-[[2-(6-aminopurin-9-yl)acetyl]amino]ethylazanium |
|---|---|
| PubChem CID | 4184659 |
| Molecular Formula | C9H14N7O+ |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-[[2-(6-aminopurin-9-yl)acetyl]amino]ethylazanium |
| SMILES | Nc1ncnc2c1ncn2CC(=O)NCC[NH3+] |
| InChI | InChI=1S/C9H13N7O/c10-1-2-12-6(17)3-16-5-15-7-8(11)13-4-14-9(7)16/h4-5H,1-3,10H2,(H,12,17)(H2,11,13,14)/p+1 |
| InChIKey | RFSSXSMNWFZDLL-UHFFFAOYSA-O |
| XLogP | -2.23 |
| TPSA | 126.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |