C11H15N5O — CID 62023866
1-(6-aminopurin-9-yl)-3,3-dimethylbutan-2-one (PubChem CID 62023866) has the molecular formula C11H15N5O and a molecular weight of 233.28 g/mol. Its IUPAC name is 1-(6-aminopurin-9-yl)-3,3-dimethylbutan-2-one.
| Compound Name | 1-(6-aminopurin-9-yl)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 62023866 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 1-(6-aminopurin-9-yl)-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C11H15N5O/c1-11(2,3)7(17)4-16-6-15-8-9(12)13-5-14-10(8)16/h5-6H,4H2,1-3H3,(H2,12,13,14) |
| InChIKey | LSCCAMKTDZRXFK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |