C9H13N5O3 — CID 14283773
2-[(6-aminopurin-9-yl)methyl]propane-1,2,3-triol (PubChem CID 14283773) has the molecular formula C9H13N5O3 and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-[(6-aminopurin-9-yl)methyl]propane-1,2,3-triol.
| Compound Name | 2-[(6-aminopurin-9-yl)methyl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 14283773 |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-[(6-aminopurin-9-yl)methyl]propane-1,2,3-triol |
| SMILES | Nc1ncnc2c1ncn2CC(O)(CO)CO |
| InChI | InChI=1S/C9H13N5O3/c10-7-6-8(12-4-11-7)14(5-13-6)1-9(17,2-15)3-16/h4-5,15-17H,1-3H2,(H2,10,11,12) |
| InChIKey | WQAFYWATYVUPBH-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |