C11H15N5O3 — CID 10706793
(3R,4S)-5-(6-aminopurin-9-yl)-2-methylidenepentane-1,3,4-triol (PubChem CID 10706793) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is (3R,4S)-5-(6-aminopurin-9-yl)-2-methylidenepentane-1,3,4-triol.
| Compound Name | (3R,4S)-5-(6-aminopurin-9-yl)-2-methylidenepentane-1,3,4-triol |
|---|---|
| PubChem CID | 10706793 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | (3R,4S)-5-(6-aminopurin-9-yl)-2-methylidenepentane-1,3,4-triol |
| SMILES | C=C(CO)[C@@H](O)[C@@H](O)Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C11H15N5O3/c1-6(3-17)9(19)7(18)2-16-5-15-8-10(12)13-4-14-11(8)16/h4-5,7,9,17-19H,1-3H2,(H2,12,13,14)/t7-,9+/m0/s1 |
| InChIKey | FXVSWPQBJGEUTD-IONNQARKSA-N |
| XLogP | -1.32 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|