C9H13FN5OP — CID 68636068
9-(3-fluoro-3-methoxy-2-phosphanylpropyl)purin-6-amine (PubChem CID 68636068) has the molecular formula C9H13FN5OP and a molecular weight of 257.21 g/mol. Its IUPAC name is 9-(3-fluoro-3-methoxy-2-phosphanylpropyl)purin-6-amine.
| Compound Name | 9-(3-fluoro-3-methoxy-2-phosphanylpropyl)purin-6-amine |
|---|---|
| PubChem CID | 68636068 |
| Molecular Formula | C9H13FN5OP |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 9-(3-fluoro-3-methoxy-2-phosphanylpropyl)purin-6-amine |
| SMILES | COC(F)C(P)Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C9H13FN5OP/c1-16-7(10)5(17)2-15-4-14-6-8(11)12-3-13-9(6)15/h3-5,7H,2,17H2,1H3,(H2,11,12,13) |
| InChIKey | YNWMMHNYFAHIDP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|