C10H15N5O3P- — CID 161403767
1-(6-aminopurin-9-yl)propan-2-yloxymethyl-methylphosphinate (PubChem CID 161403767) has the molecular formula C10H15N5O3P- and a molecular weight of 284.24 g/mol. Its IUPAC name is 1-(6-aminopurin-9-yl)propan-2-yloxymethyl-methylphosphinate.
| Compound Name | 1-(6-aminopurin-9-yl)propan-2-yloxymethyl-methylphosphinate |
|---|---|
| PubChem CID | 161403767 |
| Molecular Formula | C10H15N5O3P- |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 1-(6-aminopurin-9-yl)propan-2-yloxymethyl-methylphosphinate |
| SMILES | CC(Cn1cnc2c(N)ncnc21)OCP(C)(=O)[O-] |
| InChI | InChI=1S/C10H16N5O3P/c1-7(18-6-19(2,16)17)3-15-5-14-8-9(11)12-4-13-10(8)15/h4-5,7H,3,6H2,1-2H3,(H,16,17)(H2,11,12,13)/p-1 |
| InChIKey | VUOMMTXOCLWPLA-UHFFFAOYSA-M |
| XLogP | 0.04 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|