C17H30N5O4P — CID 172753915
9-[(2R)-2-[bis[(2-methylpropan-2-yl)oxy]phosphorylmethoxy]propyl]purin-6-amine (PubChem CID 172753915) has the molecular formula C17H30N5O4P and a molecular weight of 399.43 g/mol. Its IUPAC name is 9-[(2R)-2-[bis[(2-methylpropan-2-yl)oxy]phosphorylmethoxy]propyl]purin-6-amine.
| Compound Name | 9-[(2R)-2-[bis[(2-methylpropan-2-yl)oxy]phosphorylmethoxy]propyl]purin-6-amine |
|---|---|
| PubChem CID | 172753915 |
| Molecular Formula | C17H30N5O4P |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 9-[(2R)-2-[bis[(2-methylpropan-2-yl)oxy]phosphorylmethoxy]propyl]purin-6-amine |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C17H30N5O4P/c1-12(8-22-10-21-13-14(18)19-9-20-15(13)22)24-11-27(23,25-16(2,3)4)26-17(5,6)7/h9-10,12H,8,11H2,1-7H3,(H2,18,19,20)/t12-/m1/s1 |
| InChIKey | KTGLOXRLNKTESM-GFCCVEGCSA-N |
| XLogP | 3.59 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|