C19H30N5O6P — CID 102095743
[1-(6-aminopurin-9-yl)propan-2-yloxymethyl-(2,2-dimethylpropanoyloxy)phosphoryl] 2,2-dimethylpropanoate (PubChem CID 102095743) has the molecular formula C19H30N5O6P and a molecular weight of 455.45 g/mol. Its IUPAC name is [1-(6-aminopurin-9-yl)propan-2-yloxymethyl-(2,2-dimethylpropanoyloxy)phosphoryl] 2,2-dimethylpropanoate.
| Compound Name | [1-(6-aminopurin-9-yl)propan-2-yloxymethyl-(2,2-dimethylpropanoyloxy)phosphoryl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102095743 |
| Molecular Formula | C19H30N5O6P |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | [1-(6-aminopurin-9-yl)propan-2-yloxymethyl-(2,2-dimethylpropanoyloxy)phosphoryl] 2,2-dimethylpropanoate |
| SMILES | CC(Cn1cnc2c(N)ncnc21)OCP(=O)(OC(=O)C(C)(C)C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H30N5O6P/c1-12(8-24-10-23-13-14(20)21-9-22-15(13)24)28-11-31(27,29-16(25)18(2,3)4)30-17(26)19(5,6)7/h9-10,12H,8,11H2,1-7H3,(H2,20,21,22) |
| InChIKey | GPZWOFKZCBCAJH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|