C18H30N10O12P2S — CID 174867396
bis([(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid);sulfuric acid (PubChem CID 174867396) has the molecular formula C18H30N10O12P2S and a molecular weight of 672.51 g/mol. Its IUPAC name is bis([(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid);sulfuric acid.
| Compound Name | bis([(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid);sulfuric acid |
|---|---|
| PubChem CID | 174867396 |
| Molecular Formula | C18H30N10O12P2S |
| Molecular Weight | 672.51 g/mol |
| Exact Mass | 672.12 |
| IUPAC Name | bis([(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid);sulfuric acid |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(O)O.C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/2C9H14N5O4P.H2O4S/c2*1-6(18-5-19(15,16)17)2-14-4-13-7-8(10)11-3-12-9(7)14;1-5(2,3)4/h2*3-4,6H,2,5H2,1H3,(H2,10,11,12)(H2,15,16,17);(H2,1,2,3,4)/t2*6-;/m11./s1 |
| InChIKey | WTZAWIKUJKSXTI-GOPSZHOCSA-N |
| XLogP | -0.76 |
| TPSA | 347.36 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.51 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|