C19H34N5O6P — CID 53302476
[(2S)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid;decanoic acid (PubChem CID 53302476) has the molecular formula C19H34N5O6P and a molecular weight of 459.48 g/mol. Its IUPAC name is [(2S)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid;decanoic acid.
| Compound Name | [(2S)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid;decanoic acid |
|---|---|
| PubChem CID | 53302476 |
| Molecular Formula | C19H34N5O6P |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | [(2S)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid;decanoic acid |
| SMILES | CCCCCCCCCC(=O)O.C[C@@H](Cn1cnc2c(N)ncnc21)OCP(=O)(O)O |
| InChI | InChI=1S/C10H20O2.C9H14N5O4P/c1-2-3-4-5-6-7-8-9-10(11)12;1-6(18-5-19(15,16)17)2-14-4-13-7-8(10)11-3-12-9(7)14/h2-9H2,1H3,(H,11,12);3-4,6H,2,5H2,1H3,(H2,10,11,12)(H2,15,16,17)/t;6-/m.0/s1 |
| InChIKey | YZMMUFOCYJCZJP-ZCMDIHMWSA-N |
| XLogP | 3.16 |
| TPSA | 173.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|