C9H21N7O7P2 — CID 171381468
[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phosphonooxyphosphinic acid;azane (PubChem CID 171381468) has the molecular formula C9H21N7O7P2 and a molecular weight of 406.22 g/mol. Its IUPAC name is [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phosphonooxyphosphinic acid;azane.
| Compound Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phosphonooxyphosphinic acid;azane |
|---|---|
| PubChem CID | 171381468 |
| Molecular Formula | C9H21N7O7P2 |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phosphonooxyphosphinic acid;azane |
| SMILES | C[C@H](Cn1[13cH]n[13c]2[13c](N)n[13cH]n[13c]21)OCP(=O)(O)OP(=O)(O)O.N.N |
| InChI | InChI=1S/C9H15N5O7P2.2H3N/c1-6(20-5-22(15,16)21-23(17,18)19)2-14-4-13-7-8(10)11-3-12-9(7)14;;/h3-4,6H,2,5H2,1H3,(H,15,16)(H2,10,11,12)(H2,17,18,19);2*1H3/t6-;;/m1../s1/i3+1,4+1,7+1,8+1,9+1;; |
| InChIKey | MRKHOOBWKOPSKU-DRCDXADESA-N |
| XLogP | 0.39 |
| TPSA | 252.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|