C15H29N6O4P — CID 46183708
[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid;N-propan-2-ylpropan-2-amine (PubChem CID 46183708) has the molecular formula C15H29N6O4P and a molecular weight of 388.41 g/mol. Its IUPAC name is [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid;N-propan-2-ylpropan-2-amine.
| Compound Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid;N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 46183708 |
| Molecular Formula | C15H29N6O4P |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid;N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)NC(C)C.C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(O)O |
| InChI | InChI=1S/C9H14N5O4P.C6H15N/c1-6(18-5-19(15,16)17)2-14-4-13-7-8(10)11-3-12-9(7)14;1-5(2)7-6(3)4/h3-4,6H,2,5H2,1H3,(H2,10,11,12)(H2,15,16,17);5-7H,1-4H3/t6-;/m1./s1 |
| InChIKey | STIYRPXNXLOSBZ-FYZOBXCZSA-N |
| XLogP | 1.34 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|