C12H22N5O4P — CID 143297032
2-[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxyethylphosphonic acid;ethane (PubChem CID 143297032) has the molecular formula C12H22N5O4P and a molecular weight of 331.31 g/mol. Its IUPAC name is 2-[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxyethylphosphonic acid;ethane.
| Compound Name | 2-[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxyethylphosphonic acid;ethane |
|---|---|
| PubChem CID | 143297032 |
| Molecular Formula | C12H22N5O4P |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxyethylphosphonic acid;ethane |
| SMILES | CC.C[C@H](Cn1cnc2c(N)ncnc21)OCCP(=O)(O)O |
| InChI | InChI=1S/C10H16N5O4P.C2H6/c1-7(19-2-3-20(16,17)18)4-15-6-14-8-9(11)12-5-13-10(8)15;1-2/h5-7H,2-4H2,1H3,(H2,11,12,13)(H2,16,17,18);1-2H3/t7-;/m1./s1 |
| InChIKey | DCZZWPFHKINCMS-OGFXRTJISA-N |
| XLogP | 1.02 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|