C17H23N10O4P — CID 163197516
[(2R)-3-(6-aminopurin-9-yl)-1-[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxy-2-methylpropyl]phosphonic acid (PubChem CID 163197516) has the molecular formula C17H23N10O4P and a molecular weight of 462.41 g/mol. Its IUPAC name is [(2R)-3-(6-aminopurin-9-yl)-1-[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxy-2-methylpropyl]phosphonic acid.
| Compound Name | [(2R)-3-(6-aminopurin-9-yl)-1-[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxy-2-methylpropyl]phosphonic acid |
|---|---|
| PubChem CID | 163197516 |
| Molecular Formula | C17H23N10O4P |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | [(2R)-3-(6-aminopurin-9-yl)-1-[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxy-2-methylpropyl]phosphonic acid |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OC([C@H](C)Cn1cnc2c(N)ncnc21)P(=O)(O)O |
| InChI | InChI=1S/C17H23N10O4P/c1-9(3-26-7-24-11-13(18)20-5-22-15(11)26)17(32(28,29)30)31-10(2)4-27-8-25-12-14(19)21-6-23-16(12)27/h5-10,17H,3-4H2,1-2H3,(H2,18,20,22)(H2,19,21,23)(H2,28,29,30)/t9-,10-,17?/m1/s1 |
| InChIKey | RYZBNJWVUOTRLX-CXYCCAGISA-N |
| XLogP | 0.38 |
| TPSA | 206.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|