C13H22N5O6P — CID 175017276
[1-(6-aminopurin-9-yl)propan-2-yloxy-diethoxymethyl]phosphonic acid (PubChem CID 175017276) has the molecular formula C13H22N5O6P and a molecular weight of 375.32 g/mol. Its IUPAC name is [1-(6-aminopurin-9-yl)propan-2-yloxy-diethoxymethyl]phosphonic acid.
| Compound Name | [1-(6-aminopurin-9-yl)propan-2-yloxy-diethoxymethyl]phosphonic acid |
|---|---|
| PubChem CID | 175017276 |
| Molecular Formula | C13H22N5O6P |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [1-(6-aminopurin-9-yl)propan-2-yloxy-diethoxymethyl]phosphonic acid |
| SMILES | CCOC(OCC)(OC(C)Cn1cnc2c(N)ncnc21)P(=O)(O)O |
| InChI | InChI=1S/C13H22N5O6P/c1-4-22-13(23-5-2,25(19,20)21)24-9(3)6-18-8-17-10-11(14)15-7-16-12(10)18/h7-9H,4-6H2,1-3H3,(H2,14,15,16)(H2,19,20,21) |
| InChIKey | QJUNNRWLESPMHK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 154.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|