C12H20N5O5P — CID 58115296
[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(ethoxymethoxy)phosphinic acid (PubChem CID 58115296) has the molecular formula C12H20N5O5P and a molecular weight of 345.30 g/mol. Its IUPAC name is [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(ethoxymethoxy)phosphinic acid.
| Compound Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(ethoxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 58115296 |
| Molecular Formula | C12H20N5O5P |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(ethoxymethoxy)phosphinic acid |
| SMILES | CCOCOP(=O)(O)CO[C@H](C)Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C12H20N5O5P/c1-3-20-7-22-23(18,19)8-21-9(2)4-17-6-16-10-11(13)14-5-15-12(10)17/h5-6,9H,3-4,7-8H2,1-2H3,(H,18,19)(H2,13,14,15)/t9-/m1/s1 |
| InChIKey | KURIOSYQPFQKAY-SECBINFHSA-N |
| XLogP | 0.97 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|