C11H16N5O8P — CID 56961670
[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid;oxalic acid (PubChem CID 56961670) has the molecular formula C11H16N5O8P and a molecular weight of 377.25 g/mol. Its IUPAC name is [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid;oxalic acid.
| Compound Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid;oxalic acid |
|---|---|
| PubChem CID | 56961670 |
| Molecular Formula | C11H16N5O8P |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid;oxalic acid |
| SMILES | C[C@H](Cn1cnc2c(N)ncnc21)OCP(=O)(O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C9H14N5O4P.C2H2O4/c1-6(18-5-19(15,16)17)2-14-4-13-7-8(10)11-3-12-9(7)14;3-1(4)2(5)6/h3-4,6H,2,5H2,1H3,(H2,10,11,12)(H2,15,16,17);(H,3,4)(H,5,6)/t6-;/m1./s1 |
| InChIKey | VLDITSFEXYKXFT-FYZOBXCZSA-N |
| XLogP | -0.90 |
| TPSA | 210.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|