C16H20N5O5P — CID 118214141
[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(4-methoxyphenoxy)phosphinic acid (PubChem CID 118214141) has the molecular formula C16H20N5O5P and a molecular weight of 393.34 g/mol. Its IUPAC name is [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(4-methoxyphenoxy)phosphinic acid.
| Compound Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(4-methoxyphenoxy)phosphinic acid |
|---|---|
| PubChem CID | 118214141 |
| Molecular Formula | C16H20N5O5P |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(4-methoxyphenoxy)phosphinic acid |
| SMILES | COc1ccc(OP(=O)(O)CO[C@H](C)Cn2cnc3c(N)ncnc32)cc1 |
| InChI | InChI=1S/C16H20N5O5P/c1-11(7-21-9-20-14-15(17)18-8-19-16(14)21)25-10-27(22,23)26-13-5-3-12(24-2)4-6-13/h3-6,8-9,11H,7,10H2,1-2H3,(H,22,23)(H2,17,18,19)/t11-/m1/s1 |
| InChIKey | QMBOTBXKMIRUCD-LLVKDONJSA-N |
| XLogP | 2.04 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|