C16H19ClN5O3P — CID 123273553
9-[2-[[chloromethyl(phenoxy)phosphoryl]methoxy]propyl]purin-6-amine (PubChem CID 123273553) has the molecular formula C16H19ClN5O3P and a molecular weight of 395.79 g/mol. Its IUPAC name is 9-[2-[[chloromethyl(phenoxy)phosphoryl]methoxy]propyl]purin-6-amine.
| Compound Name | 9-[2-[[chloromethyl(phenoxy)phosphoryl]methoxy]propyl]purin-6-amine |
|---|---|
| PubChem CID | 123273553 |
| Molecular Formula | C16H19ClN5O3P |
| Molecular Weight | 395.79 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 9-[2-[[chloromethyl(phenoxy)phosphoryl]methoxy]propyl]purin-6-amine |
| SMILES | CC(Cn1cnc2c(N)ncnc21)OCP(=O)(CCl)Oc1ccccc1 |
| InChI | InChI=1S/C16H19ClN5O3P/c1-12(7-22-10-21-14-15(18)19-9-20-16(14)22)24-11-26(23,8-17)25-13-5-3-2-4-6-13/h2-6,9-10,12H,7-8,11H2,1H3,(H2,18,19,20) |
| InChIKey | YRZKSXULAKIMSB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.79 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|