C28H36N5O4P — CID 158925371
9-[(2R)-2-[[[2,2-dimethyl-3-[(2-methylphenyl)methoxy]propyl]-phenoxyphosphoryl]methoxy]propyl]purin-6-amine (PubChem CID 158925371) has the molecular formula C28H36N5O4P and a molecular weight of 537.60 g/mol. Its IUPAC name is 9-[(2R)-2-[[[2,2-dimethyl-3-[(2-methylphenyl)methoxy]propyl]-phenoxyphosphoryl]methoxy]propyl]purin-6-amine.
| Compound Name | 9-[(2R)-2-[[[2,2-dimethyl-3-[(2-methylphenyl)methoxy]propyl]-phenoxyphosphoryl]methoxy]propyl]purin-6-amine |
|---|---|
| PubChem CID | 158925371 |
| Molecular Formula | C28H36N5O4P |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 9-[(2R)-2-[[[2,2-dimethyl-3-[(2-methylphenyl)methoxy]propyl]-phenoxyphosphoryl]methoxy]propyl]purin-6-amine |
| SMILES | Cc1ccccc1COCC(C)(C)CP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)Oc1ccccc1 |
| InChI | InChI=1S/C28H36N5O4P/c1-21-10-8-9-11-23(21)15-35-16-28(3,4)17-38(34,37-24-12-6-5-7-13-24)20-36-22(2)14-33-19-32-25-26(29)30-18-31-27(25)33/h5-13,18-19,22H,14-17,20H2,1-4H3,(H2,29,30,31)/t22-,38?/m1/s1 |
| InChIKey | KCHHMKAHDYAZAF-JEDURFTISA-N |
| XLogP | 5.68 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|