C26H33N6O4P — CID 135174059
9-[(2R)-2-[[[methyl-[2-[(2-methylphenyl)methoxy]ethyl]amino]-phenoxyphosphoryl]methoxy]propyl]purin-6-amine (PubChem CID 135174059) has the molecular formula C26H33N6O4P and a molecular weight of 524.56 g/mol. Its IUPAC name is 9-[(2R)-2-[[[methyl-[2-[(2-methylphenyl)methoxy]ethyl]amino]-phenoxyphosphoryl]methoxy]propyl]purin-6-amine.
| Compound Name | 9-[(2R)-2-[[[methyl-[2-[(2-methylphenyl)methoxy]ethyl]amino]-phenoxyphosphoryl]methoxy]propyl]purin-6-amine |
|---|---|
| PubChem CID | 135174059 |
| Molecular Formula | C26H33N6O4P |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 9-[(2R)-2-[[[methyl-[2-[(2-methylphenyl)methoxy]ethyl]amino]-phenoxyphosphoryl]methoxy]propyl]purin-6-amine |
| SMILES | Cc1ccccc1COCCN(C)P(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)Oc1ccccc1 |
| InChI | InChI=1S/C26H33N6O4P/c1-20-9-7-8-10-22(20)16-34-14-13-31(3)37(33,36-23-11-5-4-6-12-23)19-35-21(2)15-32-18-30-24-25(27)28-17-29-26(24)32/h4-12,17-18,21H,13-16,19H2,1-3H3,(H2,27,28,29)/t21-,37?/m1/s1 |
| InChIKey | JTVREOYAGCJEIG-XFAQZLOPSA-N |
| XLogP | 4.50 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|