C20H29N6O4P — CID 141475805
9-[(2R)-2-[[phenoxy-[[(1R)-1-propan-2-yloxyethyl]amino]phosphoryl]methoxy]propyl]purin-6-amine (PubChem CID 141475805) has the molecular formula C20H29N6O4P and a molecular weight of 448.46 g/mol. Its IUPAC name is 9-[(2R)-2-[[phenoxy-[[(1R)-1-propan-2-yloxyethyl]amino]phosphoryl]methoxy]propyl]purin-6-amine.
| Compound Name | 9-[(2R)-2-[[phenoxy-[[(1R)-1-propan-2-yloxyethyl]amino]phosphoryl]methoxy]propyl]purin-6-amine |
|---|---|
| PubChem CID | 141475805 |
| Molecular Formula | C20H29N6O4P |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 9-[(2R)-2-[[phenoxy-[[(1R)-1-propan-2-yloxyethyl]amino]phosphoryl]methoxy]propyl]purin-6-amine |
| SMILES | CC(C)O[C@H](C)N[P@@](=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)Oc1ccccc1 |
| InChI | InChI=1S/C20H29N6O4P/c1-14(2)29-16(4)25-31(27,30-17-8-6-5-7-9-17)13-28-15(3)10-26-12-24-18-19(21)22-11-23-20(18)26/h5-9,11-12,14-16H,10,13H2,1-4H3,(H,25,27)(H2,21,22,23)/t15-,16-,31-/m1/s1 |
| InChIKey | INWIKFHPIVBBKL-ZBVVXIQFSA-N |
| XLogP | 3.40 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|